C16H19F3O2 — CID 114975308
(3,5-dimethylcyclohexyl)-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 114975308) has the molecular formula C16H19F3O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | (3,5-dimethylcyclohexyl)-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 114975308 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | CC1CC(C)CC(C(=O)c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H19F3O2/c1-10-7-11(2)9-13(8-10)15(20)12-3-5-14(6-4-12)21-16(17,18)19/h3-6,10-11,13H,7-9H2,1-2H3 |
| InChIKey | XBWQJQYBAKICBJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |