C15H14F4O3S — CID 171942628
[2-fluoro-4-(trifluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171942628) has the molecular formula C15H14F4O3S and a molecular weight of 350.33 g/mol. Its IUPAC name is [2-fluoro-4-(trifluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | [2-fluoro-4-(trifluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171942628 |
| Molecular Formula | C15H14F4O3S |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [2-fluoro-4-(trifluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1F)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C15H14F4O3S/c16-13-7-9(22-15(17,18)19)1-4-12(13)14(20)8-5-10-2-3-11(6-8)23(10)21/h1,4,7-8,10-11H,2-3,5-6H2 |
| InChIKey | XXJVJQSHVWEQAE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |