C16H19FO2S — CID 171944912
(3-fluoro-5-methylphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171944912) has the molecular formula C16H19FO2S and a molecular weight of 294.39 g/mol. Its IUPAC name is (3-fluoro-5-methylphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | (3-fluoro-5-methylphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171944912 |
| Molecular Formula | C16H19FO2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3-fluoro-5-methylphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | Cc1cc(F)cc(C(=O)C2CC3CCCC(C2)S3=O)c1 |
| InChI | InChI=1S/C16H19FO2S/c1-10-5-11(7-13(17)6-10)16(18)12-8-14-3-2-4-15(9-12)20(14)19/h5-7,12,14-15H,2-4,8-9H2,1H3 |
| InChIKey | SIHDMZIEJJRMIN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |