C17H21FO2S — CID 171948152
2-(5-fluoro-2-methylphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone (PubChem CID 171948152) has the molecular formula C17H21FO2S and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone |
|---|---|
| PubChem CID | 171948152 |
| Molecular Formula | C17H21FO2S |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)ethanone |
| SMILES | Cc1ccc(F)cc1CC(=O)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C17H21FO2S/c1-11-5-6-14(18)7-12(11)10-17(19)13-8-15-3-2-4-16(9-13)21(15)20/h5-7,13,15-16H,2-4,8-10H2,1H3 |
| InChIKey | PRTJDLPCYHQZLB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |