C13H15FOS — CID 105373334
2-(5-fluoro-2-methylphenyl)-1-(thiolan-2-yl)ethanone (PubChem CID 105373334) has the molecular formula C13H15FOS and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-1-(thiolan-2-yl)ethanone.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-1-(thiolan-2-yl)ethanone |
|---|---|
| PubChem CID | 105373334 |
| Molecular Formula | C13H15FOS |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-1-(thiolan-2-yl)ethanone |
| SMILES | Cc1ccc(F)cc1CC(=O)C1CCCS1 |
| InChI | InChI=1S/C13H15FOS/c1-9-4-5-11(14)7-10(9)8-12(15)13-3-2-6-16-13/h4-5,7,13H,2-3,6,8H2,1H3 |
| InChIKey | CBDWDERWEZFNCK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |