C12H12Cl2OS — CID 80621705
2-(2,4-dichlorophenyl)-1-(thiolan-2-yl)ethanone (PubChem CID 80621705) has the molecular formula C12H12Cl2OS and a molecular weight of 275.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(thiolan-2-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(thiolan-2-yl)ethanone |
|---|---|
| PubChem CID | 80621705 |
| Molecular Formula | C12H12Cl2OS |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(thiolan-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)C1CCCS1 |
| InChI | InChI=1S/C12H12Cl2OS/c13-9-4-3-8(10(14)7-9)6-11(15)12-2-1-5-16-12/h3-4,7,12H,1-2,5-6H2 |
| InChIKey | VCKZESLVRMWSGP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |