C18H20Cl2O — CID 114967204
1-(2-adamantyl)-2-(2,4-dichlorophenyl)ethanone (PubChem CID 114967204) has the molecular formula C18H20Cl2O and a molecular weight of 323.26 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(2,4-dichlorophenyl)ethanone.
| Compound Name | 1-(2-adamantyl)-2-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 114967204 |
| Molecular Formula | C18H20Cl2O |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-(2-adamantyl)-2-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H20Cl2O/c19-15-2-1-12(16(20)9-15)8-17(21)18-13-4-10-3-11(6-13)7-14(18)5-10/h1-2,9-11,13-14,18H,3-8H2 |
| InChIKey | VMTNEEYUDZQHOD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |