C18H20Cl2O2 — CID 4285258
(2,4-dichlorophenyl)methyl adamantane-1-carboxylate (PubChem CID 4285258) has the molecular formula C18H20Cl2O2 and a molecular weight of 339.26 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl adamantane-1-carboxylate.
| Compound Name | (2,4-dichlorophenyl)methyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4285258 |
| Molecular Formula | C18H20Cl2O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2,4-dichlorophenyl)methyl adamantane-1-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)cc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H20Cl2O2/c19-15-2-1-14(16(20)6-15)10-22-17(21)18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13H,3-5,7-10H2 |
| InChIKey | DKWQQQNFSKVAII-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |