C20H25Cl2NO — CID 7929641
N-[(1S)-1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)acetamide (PubChem CID 7929641) has the molecular formula C20H25Cl2NO and a molecular weight of 366.33 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7929641 |
| Molecular Formula | C20H25Cl2NO |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)acetamide |
| SMILES | C[C@H](NC(=O)Cc1ccc(Cl)cc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25Cl2NO/c1-12(20-9-13-4-14(10-20)6-15(5-13)11-20)23-19(24)7-16-2-3-17(21)8-18(16)22/h2-3,8,12-15H,4-7,9-11H2,1H3,(H,23,24)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | AUEPUFWVIHANHS-PGBBXINNSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |