C23H32ClNO2 — CID 40563664
N-[(1S)-1-(1-adamantyl)ethyl]-4-(4-chloro-2-methylphenoxy)butanamide (PubChem CID 40563664) has the molecular formula C23H32ClNO2 and a molecular weight of 389.97 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-(4-chloro-2-methylphenoxy)butanamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(4-chloro-2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 40563664 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(4-chloro-2-methylphenoxy)butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)N[C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H32ClNO2/c1-15-8-20(24)5-6-21(15)27-7-3-4-22(26)25-16(2)23-12-17-9-18(13-23)11-19(10-17)14-23/h5-6,8,16-19H,3-4,7,9-14H2,1-2H3,(H,25,26)/t16-,17?,18?,19?,23?/m0/s1 |
| InChIKey | HPBBGWUXDJFRMV-LXGFQCHUSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|