C26H39NO2 — CID 4280324
N-[1-(1-adamantyl)ethyl]-4-(4-tert-butylphenoxy)butanamide (PubChem CID 4280324) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-4-(4-tert-butylphenoxy)butanamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-4-(4-tert-butylphenoxy)butanamide |
|---|---|
| PubChem CID | 4280324 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-4-(4-tert-butylphenoxy)butanamide |
| SMILES | CC(NC(=O)CCCOc1ccc(C(C)(C)C)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H39NO2/c1-18(26-15-19-12-20(16-26)14-21(13-19)17-26)27-24(28)6-5-11-29-23-9-7-22(8-10-23)25(2,3)4/h7-10,18-21H,5-6,11-17H2,1-4H3,(H,27,28) |
| InChIKey | HPBMTDZFMJIHFB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|