C26H38N2O2 — CID 7929308
N-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-3-oxopropyl]-4-tert-butylbenzamide (PubChem CID 7929308) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is N-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-3-oxopropyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-3-oxopropyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 7929308 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | N-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-3-oxopropyl]-4-tert-butylbenzamide |
| SMILES | C[C@@H](NC(=O)CCNC(=O)c1ccc(C(C)(C)C)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H38N2O2/c1-17(26-14-18-11-19(15-26)13-20(12-18)16-26)28-23(29)9-10-27-24(30)21-5-7-22(8-6-21)25(2,3)4/h5-8,17-20H,9-16H2,1-4H3,(H,27,30)(H,28,29)/t17-,18?,19?,20?,26?/m1/s1 |
| InChIKey | IMZQJSQLLMDRGY-ZFGQVMFLSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |