C23H33N3O3 — CID 17454177
N-[1-(1-adamantyl)ethyl]-3-[(4-methoxyphenyl)carbamoylamino]propanamide (PubChem CID 17454177) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3-[(4-methoxyphenyl)carbamoylamino]propanamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3-[(4-methoxyphenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 17454177 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3-[(4-methoxyphenyl)carbamoylamino]propanamide |
| SMILES | COc1ccc(NC(=O)NCCC(=O)NC(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H33N3O3/c1-15(23-12-16-9-17(13-23)11-18(10-16)14-23)25-21(27)7-8-24-22(28)26-19-3-5-20(29-2)6-4-19/h3-6,15-18H,7-14H2,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | WPYCPMAGRVBYFA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |