C28H34N2O4 — CID 5234660
N-[1-(1-adamantyl)ethyl]-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide (PubChem CID 5234660) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 5234660 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)NC(C)C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C28H34N2O4/c1-18(28-14-19-10-20(15-28)12-21(11-19)16-28)29-27(32)22-6-8-24(9-7-22)34-17-26(31)30-23-4-3-5-25(13-23)33-2/h3-9,13,18-21H,10-12,14-17H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | CCPVJVLDFNJXCI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |