C21H29NO3 — CID 2834608
N-[1-(1-adamantyl)ethyl]-3,5-dimethoxybenzamide (PubChem CID 2834608) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 2834608 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H29NO3/c1-13(21-10-14-4-15(11-21)6-16(5-14)12-21)22-20(23)17-7-18(24-2)9-19(8-17)25-3/h7-9,13-16H,4-6,10-12H2,1-3H3,(H,22,23) |
| InChIKey | IDKBLYSMKPRUNH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |