C24H33NO2 — CID 7309799
N-[(1S)-1-(1-adamantyl)ethyl]-4-cyclopentyloxybenzamide (PubChem CID 7309799) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-cyclopentyloxybenzamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-cyclopentyloxybenzamide |
|---|---|
| PubChem CID | 7309799 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-cyclopentyloxybenzamide |
| SMILES | C[C@H](NC(=O)c1ccc(OC2CCCC2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33NO2/c1-16(24-13-17-10-18(14-24)12-19(11-17)15-24)25-23(26)20-6-8-22(9-7-20)27-21-4-2-3-5-21/h6-9,16-19,21H,2-5,10-15H2,1H3,(H,25,26)/t16-,17?,18?,19?,24?/m0/s1 |
| InChIKey | SPSFWHAUWCSMKW-RNXZQOMOSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |