C21H29NOS — CID 7929515
N-[(1R)-1-(1-adamantyl)ethyl]-4-(methylsulfanylmethyl)benzamide (PubChem CID 7929515) has the molecular formula C21H29NOS and a molecular weight of 343.54 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-4-(methylsulfanylmethyl)benzamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-4-(methylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 7929515 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-4-(methylsulfanylmethyl)benzamide |
| SMILES | CSCc1ccc(C(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H29NOS/c1-14(21-10-16-7-17(11-21)9-18(8-16)12-21)22-20(23)19-5-3-15(4-6-19)13-24-2/h3-6,14,16-18H,7-13H2,1-2H3,(H,22,23)/t14-,16?,17?,18?,21?/m1/s1 |
| InChIKey | UVVKQWBYQWFPSD-RWLLOJOVSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |