C21H29NO3S — CID 7689154
N-[(1S)-1-(1-adamantyl)ethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 7689154) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 7689154 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(CS(C)(=O)=O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H29NO3S/c1-14(21-10-16-7-17(11-21)9-18(8-16)12-21)22-20(23)19-5-3-15(4-6-19)13-26(2,24)25/h3-6,14,16-18H,7-13H2,1-2H3,(H,22,23)/t14-,16?,17?,18?,21?/m0/s1 |
| InChIKey | GLGUHLYJZYGTJD-OSONQDNFSA-N |
| XLogP | 3.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |