C18H25NOS — CID 8025209
N-[(1S)-1-(1-adamantyl)ethyl]-5-methylthiophene-2-carboxamide (PubChem CID 8025209) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 8025209 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](C)C23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C18H25NOS/c1-11-3-4-16(21-11)17(20)19-12(2)18-8-13-5-14(9-18)7-15(6-13)10-18/h3-4,12-15H,5-10H2,1-2H3,(H,19,20)/t12-,13?,14?,15?,18?/m0/s1 |
| InChIKey | NBDGPSQCPLEUES-IHWZXDPASA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |