C26H30N2OS — CID 92693071
N-[(1R)-1-(1-adamantyl)ethyl]-5-(2-methylindol-1-yl)thiophene-2-carboxamide (PubChem CID 92693071) has the molecular formula C26H30N2OS and a molecular weight of 418.61 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-5-(2-methylindol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-5-(2-methylindol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92693071 |
| Molecular Formula | C26H30N2OS |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-5-(2-methylindol-1-yl)thiophene-2-carboxamide |
| SMILES | Cc1cc2ccccc2n1-c1ccc(C(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C26H30N2OS/c1-16-9-21-5-3-4-6-22(21)28(16)24-8-7-23(30-24)25(29)27-17(2)26-13-18-10-19(14-26)12-20(11-18)15-26/h3-9,17-20H,10-15H2,1-2H3,(H,27,29)/t17-,18?,19?,20?,26?/m1/s1 |
| InChIKey | SGLAIXZHCKMONB-ZFGQVMFLSA-N |
| XLogP | 6.34 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |