C26H31NO2 — CID 3762847
N-[1-(1-adamantyl)ethyl]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 3762847) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3762847 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CC(NC(=O)C(O)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H31NO2/c1-18(25-15-19-12-20(16-25)14-21(13-19)17-25)27-24(28)26(29,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-11,18-21,29H,12-17H2,1H3,(H,27,28) |
| InChIKey | DYMJFXXSSDSATL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |