C20H28N2O2 — CID 108866526
1-[1-(1-adamantyl)ethyl]-3-(2-methoxyphenyl)urea (PubChem CID 108866526) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)ethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[1-(1-adamantyl)ethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 108866526 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[1-(1-adamantyl)ethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28N2O2/c1-13(20-10-14-7-15(11-20)9-16(8-14)12-20)21-19(23)22-17-5-3-4-6-18(17)24-2/h3-6,13-16H,7-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | YEUUZSUFGGIPKT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |