C20H28N2O2 — CID 9358506
(2R)-2-(1-adamantylamino)-N-(2-methoxyphenyl)propanamide (PubChem CID 9358506) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (2R)-2-(1-adamantylamino)-N-(2-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-(1-adamantylamino)-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 9358506 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2R)-2-(1-adamantylamino)-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28N2O2/c1-13(19(23)21-17-5-3-4-6-18(17)24-2)22-20-10-14-7-15(11-20)9-16(8-14)12-20/h3-6,13-16,22H,7-12H2,1-2H3,(H,21,23)/t13-,14?,15?,16?,20?/m1/s1 |
| InChIKey | MAJSZYSYPJOUKL-XXWNAHEMSA-N |
| XLogP | 3.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |