C21H27NO4 — CID 8519609
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] adamantane-2-carboxylate (PubChem CID 8519609) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] adamantane-2-carboxylate.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519609 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] adamantane-2-carboxylate |
| SMILES | COc1ccccc1NC(=O)[C@H](C)OC(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H27NO4/c1-12(20(23)22-17-5-3-4-6-18(17)25-2)26-21(24)19-15-8-13-7-14(10-15)11-16(19)9-13/h3-6,12-16,19H,7-11H2,1-2H3,(H,22,23)/t12-,13?,14?,15?,16?,19?/m0/s1 |
| InChIKey | NTFRGPXTALSZDA-CYFGEWFFSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |