C22H30N2O3 — CID 55372437
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] adamantane-2-carboxylate (PubChem CID 55372437) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] adamantane-2-carboxylate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 55372437 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] adamantane-2-carboxylate |
| SMILES | CC(OC(=O)C1C2CC3CC(C2)CC1C3)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O3/c1-13(21(25)23-18-4-6-19(7-5-18)24(2)3)27-22(26)20-16-9-14-8-15(11-16)12-17(20)10-14/h4-7,13-17,20H,8-12H2,1-3H3,(H,23,25) |
| InChIKey | FPUCEQBXVPAPEE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|