C22H29N3O5 — CID 42899080
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 42899080) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 42899080 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | CC(OC(=O)CCN1C(=O)C2CCCCC2C1=O)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O5/c1-14(20(27)23-15-8-10-16(11-9-15)24(2)3)30-19(26)12-13-25-21(28)17-6-4-5-7-18(17)22(25)29/h8-11,14,17-18H,4-7,12-13H2,1-3H3,(H,23,27) |
| InChIKey | CVAOUIADNJTFKA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|