C13H17NO4 — CID 7851261
[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] propanoate (PubChem CID 7851261) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] propanoate.
| Compound Name | [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] propanoate |
|---|---|
| PubChem CID | 7851261 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl] propanoate |
| SMILES | CCC(=O)O[C@H](C)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C13H17NO4/c1-4-12(15)18-9(2)13(16)14-10-7-5-6-8-11(10)17-3/h5-9H,4H2,1-3H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | XLCBUJNMOVAPMC-SECBINFHSA-N |
| XLogP | 1.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |