C16H19NO6 — CID 40577642
1-O-ethyl 4-O-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (E)-but-2-enedioate (PubChem CID 40577642) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 40577642 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-O-ethyl 4-O-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)O[C@@H](C)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C16H19NO6/c1-4-22-14(18)9-10-15(19)23-11(2)16(20)17-12-7-5-6-8-13(12)21-3/h5-11H,4H2,1-3H3,(H,17,20)/b10-9+/t11-/m0/s1 |
| InChIKey | BWMWQLZYGMTQBI-USKTWTLRSA-N |
| XLogP | 1.68 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|