C20H23NO4 — CID 7265946
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (3S)-3-phenylbutanoate (PubChem CID 7265946) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (3S)-3-phenylbutanoate.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7265946 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] (3S)-3-phenylbutanoate |
| SMILES | COc1ccccc1NC(=O)[C@H](C)OC(=O)C[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4/c1-14(16-9-5-4-6-10-16)13-19(22)25-15(2)20(23)21-17-11-7-8-12-18(17)24-3/h4-12,14-15H,13H2,1-3H3,(H,21,23)/t14-,15-/m0/s1 |
| InChIKey | JXEQKMMDEIBUQW-GJZGRUSLSA-N |
| XLogP | 3.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |