C19H18F3NO3 — CID 7266001
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3R)-3-phenylbutanoate (PubChem CID 7266001) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3R)-3-phenylbutanoate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3R)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7266001 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (3R)-3-phenylbutanoate |
| SMILES | C[C@H](OC(=O)C[C@@H](C)c1ccccc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H18F3NO3/c1-11(13-6-4-3-5-7-13)10-16(24)26-12(2)19(25)23-15-9-8-14(20)17(21)18(15)22/h3-9,11-12H,10H2,1-2H3,(H,23,25)/t11-,12+/m1/s1 |
| InChIKey | OJJHPNLTKWBVDQ-NEPJUHHUSA-N |
| XLogP | 4.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|