C20H20F3N3O4 — CID 71846933
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-pyridin-4-ylbutanoate (PubChem CID 71846933) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-pyridin-4-ylbutanoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 71846933 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-pyridin-4-ylbutanoate |
| SMILES | CC(OC(=O)CC(C)c1ccncc1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H20F3N3O4/c1-11(13-5-7-24-8-6-13)9-17(28)30-12(2)20(29)25-10-16(27)26-15-4-3-14(21)18(22)19(15)23/h3-8,11-12H,9-10H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | HAYZYJOHXZRLNA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|