C18H16F3N3O6 — CID 42979813
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(furan-2-carbonylamino)acetate (PubChem CID 42979813) has the molecular formula C18H16F3N3O6 and a molecular weight of 427.34 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 42979813 |
| Molecular Formula | C18H16F3N3O6 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-(furan-2-carbonylamino)acetate |
| SMILES | CC(OC(=O)CNC(=O)c1ccco1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3N3O6/c1-9(30-14(26)8-23-18(28)12-3-2-6-29-12)17(27)22-7-13(25)24-11-5-4-10(19)15(20)16(11)21/h2-6,9H,7-8H2,1H3,(H,22,27)(H,23,28)(H,24,25) |
| InChIKey | YFQTWMXDKKTXAF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|