C16H15ClN2O5 — CID 7879966
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)acetate (PubChem CID 7879966) has the molecular formula C16H15ClN2O5 and a molecular weight of 350.76 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7879966 |
| Molecular Formula | C16H15ClN2O5 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(furan-2-carbonylamino)acetate |
| SMILES | C[C@@H](OC(=O)CNC(=O)c1ccco1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2O5/c1-10(15(21)19-12-6-4-11(17)5-7-12)24-14(20)9-18-16(22)13-3-2-8-23-13/h2-8,10H,9H2,1H3,(H,18,22)(H,19,21)/t10-/m1/s1 |
| InChIKey | AKEZWBMZOVZRNE-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |