C16H13F3N2O4S — CID 7808033
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 7808033) has the molecular formula C16H13F3N2O4S and a molecular weight of 386.35 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7808033 |
| Molecular Formula | C16H13F3N2O4S |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | C[C@H](OC(=O)CNC(=O)c1cccs1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H13F3N2O4S/c1-8(15(23)21-10-5-4-9(17)13(18)14(10)19)25-12(22)7-20-16(24)11-3-2-6-26-11/h2-6,8H,7H2,1H3,(H,20,24)(H,21,23)/t8-/m0/s1 |
| InChIKey | WXNZUXLUUMESJU-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|