C18H16F3NO3 — CID 7654630
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenylpropanoate (PubChem CID 7654630) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenylpropanoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 7654630 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenylpropanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccccc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3NO3/c1-11(25-15(23)10-7-12-5-3-2-4-6-12)18(24)22-14-9-8-13(19)16(20)17(14)21/h2-6,8-9,11H,7,10H2,1H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | ZKXFVKKJQUKJEJ-LLVKDONJSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|