C18H16F3NO4 — CID 9139857
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenoxypropanoate (PubChem CID 9139857) has the molecular formula C18H16F3NO4 and a molecular weight of 367.32 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenoxypropanoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenoxypropanoate |
|---|---|
| PubChem CID | 9139857 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-phenoxypropanoate |
| SMILES | C[C@@H](OC(=O)CCOc1ccccc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3NO4/c1-11(18(24)22-14-8-7-13(19)16(20)17(14)21)26-15(23)9-10-25-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | IVNFNFZWGJXIHD-LLVKDONJSA-N |
| XLogP | 3.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|