C18H15ClF3NO3S — CID 42973453
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-chlorophenyl)sulfanylpropanoate (PubChem CID 42973453) has the molecular formula C18H15ClF3NO3S and a molecular weight of 417.84 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-chlorophenyl)sulfanylpropanoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 42973453 |
| Molecular Formula | C18H15ClF3NO3S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-chlorophenyl)sulfanylpropanoate |
| SMILES | CC(OC(=O)CCSc1ccccc1Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H15ClF3NO3S/c1-10(18(25)23-13-7-6-12(20)16(21)17(13)22)26-15(24)8-9-27-14-5-3-2-4-11(14)19/h2-7,10H,8-9H2,1H3,(H,23,25) |
| InChIKey | LHPSNBWLWXLXKP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|