C15H11ClF3NOS — CID 7761137
(2R)-2-(2-chlorophenyl)sulfanyl-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7761137) has the molecular formula C15H11ClF3NOS and a molecular weight of 345.77 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)sulfanyl-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-(2-chlorophenyl)sulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7761137 |
| Molecular Formula | C15H11ClF3NOS |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)sulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](Sc1ccccc1Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H11ClF3NOS/c1-8(22-12-5-3-2-4-9(12)16)15(21)20-11-7-6-10(17)13(18)14(11)19/h2-8H,1H3,(H,20,21)/t8-/m1/s1 |
| InChIKey | YRBOXMVGTXDXBR-MRVPVSSYSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|