C19H14F3NOS — CID 7793139
(2R)-2-naphthalen-2-ylsulfanyl-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7793139) has the molecular formula C19H14F3NOS and a molecular weight of 361.39 g/mol. Its IUPAC name is (2R)-2-naphthalen-2-ylsulfanyl-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-naphthalen-2-ylsulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7793139 |
| Molecular Formula | C19H14F3NOS |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (2R)-2-naphthalen-2-ylsulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](Sc1ccc2ccccc2c1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H14F3NOS/c1-11(19(24)23-16-9-8-15(20)17(21)18(16)22)25-14-7-6-12-4-2-3-5-13(12)10-14/h2-11H,1H3,(H,23,24)/t11-/m1/s1 |
| InChIKey | ICTIZLXBRKETBJ-LLVKDONJSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|