C23H15ClF3N3O2S — CID 4817487
2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 4817487) has the molecular formula C23H15ClF3N3O2S and a molecular weight of 489.91 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 4817487 |
| Molecular Formula | C23H15ClF3N3O2S |
| Molecular Weight | 489.91 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1-c1ccccc1Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H15ClF3N3O2S/c1-12(21(31)28-17-11-10-15(25)19(26)20(17)27)33-23-29-16-8-4-2-6-13(16)22(32)30(23)18-9-5-3-7-14(18)24/h2-12H,1H3,(H,28,31) |
| InChIKey | VHABCBOYRRZYEM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.91 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|