C19H17ClF3NO3S — CID 46618612
[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 46618612) has the molecular formula C19H17ClF3NO3S and a molecular weight of 431.86 g/mol. Its IUPAC name is [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 46618612 |
| Molecular Formula | C19H17ClF3NO3S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CC(OC(=O)CCSc1ccc(Cl)cc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H17ClF3NO3S/c1-12(18(26)24-16-5-3-2-4-15(16)19(21,22)23)27-17(25)10-11-28-14-8-6-13(20)7-9-14/h2-9,12H,10-11H2,1H3,(H,24,26) |
| InChIKey | PTXQLXGORVQKJG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |