C18H15ClF3NO3S — CID 35577296
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 35577296) has the molecular formula C18H15ClF3NO3S and a molecular weight of 417.84 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 35577296 |
| Molecular Formula | C18H15ClF3NO3S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccc(Cl)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H15ClF3NO3S/c19-12-5-7-13(8-6-12)27-10-9-17(25)26-11-16(24)23-15-4-2-1-3-14(15)18(20,21)22/h1-8H,9-11H2,(H,23,24) |
| InChIKey | ODEJVGJOCYPPAN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |