C16H14ClFN2O3S — CID 7650872
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7650872) has the molecular formula C16H14ClFN2O3S and a molecular weight of 368.82 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7650872 |
| Molecular Formula | C16H14ClFN2O3S |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccc(F)cc1)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H14ClFN2O3S/c17-16-13(2-1-8-19-16)20-14(21)10-23-15(22)7-9-24-12-5-3-11(18)4-6-12/h1-6,8H,7,9-10H2,(H,20,21) |
| InChIKey | FJRDOSIQWKOEJM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|