C17H16FNO3S — CID 7651113
(2-anilino-2-oxoethyl) 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7651113) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | (2-anilino-2-oxoethyl) 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7651113 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2-anilino-2-oxoethyl) 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccc(F)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C17H16FNO3S/c18-13-6-8-15(9-7-13)23-11-10-17(21)22-12-16(20)19-14-4-2-1-3-5-14/h1-9H,10-12H2,(H,19,20) |
| InChIKey | RFDMLAANWULZKE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |