C19H21FN2O3S — CID 7762079
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7762079) has the molecular formula C19H21FN2O3S and a molecular weight of 376.45 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7762079 |
| Molecular Formula | C19H21FN2O3S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)CCSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN2O3S/c1-22(2)16-7-5-15(6-8-16)21-18(23)13-25-19(24)11-12-26-17-9-3-14(20)4-10-17/h3-10H,11-13H2,1-2H3,(H,21,23) |
| InChIKey | NPYVXANVMXUUKL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|