C19H18F2N2O4S — CID 8821822
[2-(4-acetamidoanilino)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate (PubChem CID 8821822) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8821822 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 3-(3,4-difluorophenyl)sulfanylpropanoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)CCSc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H18F2N2O4S/c1-12(24)22-13-2-4-14(5-3-13)23-18(25)11-27-19(26)8-9-28-15-6-7-16(20)17(21)10-15/h2-7,10H,8-9,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GSUMCARDFZOIHT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |