C20H20ClNO4S — CID 7191807
[2-(4-acetylanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 7191807) has the molecular formula C20H20ClNO4S and a molecular weight of 405.90 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 7191807 |
| Molecular Formula | C20H20ClNO4S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)CCCSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClNO4S/c1-14(23)15-4-8-17(9-5-15)22-19(24)13-26-20(25)3-2-12-27-18-10-6-16(21)7-11-18/h4-11H,2-3,12-13H2,1H3,(H,22,24) |
| InChIKey | IZYGQVXJXWYSIB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|