C15H18ClNO5S — CID 7191756
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 7191756) has the molecular formula C15H18ClNO5S and a molecular weight of 359.83 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 7191756 |
| Molecular Formula | C15H18ClNO5S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO5S/c1-2-21-15(20)17-13(18)10-22-14(19)4-3-9-23-12-7-5-11(16)6-8-12/h5-8H,2-4,9-10H2,1H3,(H,17,18,20) |
| InChIKey | FXZWUPJQHXRSLI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|