C16H21ClN2O4S — CID 8578363
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 8578363) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8578363 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClN2O4S/c1-2-8-18-14(20)10-19-15(21)11-23-16(22)7-9-24-13-5-3-12(17)4-6-13/h3-6H,2,7-11H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | ZRZVQPZBRBGXDY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |