C18H24ClNO3S — CID 7840897
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 7840897) has the molecular formula C18H24ClNO3S and a molecular weight of 369.91 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7840897 |
| Molecular Formula | C18H24ClNO3S |
| Molecular Weight | 369.91 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CC1CCC(NC(=O)COC(=O)CCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H24ClNO3S/c1-13-2-6-15(7-3-13)20-17(21)12-23-18(22)10-11-24-16-8-4-14(19)5-9-16/h4-5,8-9,13,15H,2-3,6-7,10-12H2,1H3,(H,20,21) |
| InChIKey | MYYIXEOYYJMKNE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |